C9H13NO — CID 67962900
6-[(Z)-1-aminoprop-1-enyl]cyclohexa-1,3-dien-1-ol (PubChem CID 67962900) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 6-[(Z)-1-aminoprop-1-enyl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 6-[(Z)-1-aminoprop-1-enyl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 67962900 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 6-[(Z)-1-aminoprop-1-enyl]cyclohexa-1,3-dien-1-ol |
| SMILES | C/C=C(\N)C1CC=CC=C1O |
| InChI | InChI=1S/C9H13NO/c1-2-8(10)7-5-3-4-6-9(7)11/h2-4,6-7,11H,5,10H2,1H3/b8-2- |
| InChIKey | CCVOSBCOJXRXFS-WAPJZHGLSA-N |
| XLogP | 1.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |