C15H23NO — CID 143357506
acetylene;(1E)-3-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol;ethane (PubChem CID 143357506) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is acetylene;(1E)-3-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol;ethane.
| Compound Name | acetylene;(1E)-3-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol;ethane |
|---|---|
| PubChem CID | 143357506 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | acetylene;(1E)-3-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol;ethane |
| SMILES | C#C.C=C(N)/C=C(/O)C1C=CC=CC1C.CC |
| InChI | InChI=1S/C11H15NO.C2H6.C2H2/c1-8-5-3-4-6-10(8)11(13)7-9(2)12;2*1-2/h3-8,10,13H,2,12H2,1H3;1-2H3;1-2H/b11-7+;; |
| InChIKey | GFFIFWZOPIUKHD-FCVAESPPSA-N |
| XLogP | 3.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|