C14H19NO — CID 144658807
2-[(3Z,5E)-6-aminohepta-1,3,5-trien-2-yl]-6-methylcyclohexa-1,3-dien-1-ol (PubChem CID 144658807) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[(3Z,5E)-6-aminohepta-1,3,5-trien-2-yl]-6-methylcyclohexa-1,3-dien-1-ol.
| Compound Name | 2-[(3Z,5E)-6-aminohepta-1,3,5-trien-2-yl]-6-methylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 144658807 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-[(3Z,5E)-6-aminohepta-1,3,5-trien-2-yl]-6-methylcyclohexa-1,3-dien-1-ol |
| SMILES | C=C(/C=C\C=C(/C)N)C1=C(O)C(C)CC=C1 |
| InChI | InChI=1S/C14H19NO/c1-10(6-4-8-12(3)15)13-9-5-7-11(2)14(13)16/h4-6,8-9,11,16H,1,7,15H2,2-3H3/b6-4-,12-8+ |
| InChIKey | DZUSRQHBBPSCJC-XWBYBSRJSA-N |
| XLogP | 3.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|