C23H27N3O7S — CID 142986356
N-(2,4,6-trimethoxypyrimidin-5-yl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4λ4-benzoxathiin-6-yl)oxy]furan-2-carboxamide (PubChem CID 142986356) has the molecular formula C23H27N3O7S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-(2,4,6-trimethoxypyrimidin-5-yl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4λ4-benzoxathiin-6-yl)oxy]furan-2-carboxamide.
| Compound Name | N-(2,4,6-trimethoxypyrimidin-5-yl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4λ4-benzoxathiin-6-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 142986356 |
| Molecular Formula | C23H27N3O7S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | N-(2,4,6-trimethoxypyrimidin-5-yl)-5-[(4,4,7-trimethyl-2,3-dihydro-1,4λ4-benzoxathiin-6-yl)oxy]furan-2-carboxamide |
| SMILES | COc1nc(OC)c(NC(=O)c2ccc(Oc3cc4c(cc3C)OCCS4(C)C)o2)c(OC)n1 |
| InChI | InChI=1S/C23H27N3O7S/c1-13-11-16-17(34(5,6)10-9-31-16)12-15(13)33-18-8-7-14(32-18)20(27)24-19-21(28-2)25-23(30-4)26-22(19)29-3/h7-8,11-12H,9-10H2,1-6H3,(H,24,27) |
| InChIKey | ORWWRKKCXTZNHB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |