C11H15NO5 — CID 142986733
3-(hydroxymethoxyamino)-5-propan-2-yloxybenzoic acid (PubChem CID 142986733) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 3-(hydroxymethoxyamino)-5-propan-2-yloxybenzoic acid.
| Compound Name | 3-(hydroxymethoxyamino)-5-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 142986733 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-(hydroxymethoxyamino)-5-propan-2-yloxybenzoic acid |
| SMILES | CC(C)Oc1cc(NOCO)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO5/c1-7(2)17-10-4-8(11(14)15)3-9(5-10)12-16-6-13/h3-5,7,12-13H,6H2,1-2H3,(H,14,15) |
| InChIKey | YVXQKTCTJVLRQN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|