C26H27BrN4O3 — CID 142987043
1-(8-bromo-5-methoxy-4,9-dimethyl-1H-azonin-3-yl)-2-(4-isoquinolin-1-ylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 142987043) has the molecular formula C26H27BrN4O3 and a molecular weight of 523.43 g/mol. Its IUPAC name is 1-(8-bromo-5-methoxy-4,9-dimethyl-1H-azonin-3-yl)-2-(4-isoquinolin-1-ylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(8-bromo-5-methoxy-4,9-dimethyl-1H-azonin-3-yl)-2-(4-isoquinolin-1-ylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 142987043 |
| Molecular Formula | C26H27BrN4O3 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 1-(8-bromo-5-methoxy-4,9-dimethyl-1H-azonin-3-yl)-2-(4-isoquinolin-1-ylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | COc1ccc(Br)c(C)[nH]cc(C(=O)C(=O)N2CCN(c3nccc4ccccc34)CC2)c1C |
| InChI | InChI=1S/C26H27BrN4O3/c1-17-21(16-29-18(2)22(27)8-9-23(17)34-3)24(32)26(33)31-14-12-30(13-15-31)25-20-7-5-4-6-19(20)10-11-28-25/h4-11,16,29H,12-15H2,1-3H3/b9-8-,21-16+,22-18+,23-17+ |
| InChIKey | PWFFJFIDBLRXMZ-VSULGGGYSA-N |
| XLogP | 4.61 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|