C28H28N8O5 — CID 88928359
2-[amino-[(Z)-[[3-[2-(4-isoquinolin-1-ylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]-(methylideneamino)methylidene]amino]amino]acetic acid (PubChem CID 88928359) has the molecular formula C28H28N8O5 and a molecular weight of 556.58 g/mol. Its IUPAC name is 2-[amino-[(Z)-[[3-[2-(4-isoquinolin-1-ylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]-(methylideneamino)methylidene]amino]amino]acetic acid.
| Compound Name | 2-[amino-[(Z)-[[3-[2-(4-isoquinolin-1-ylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]-(methylideneamino)methylidene]amino]amino]acetic acid |
|---|---|
| PubChem CID | 88928359 |
| Molecular Formula | C28H28N8O5 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 2-[amino-[(Z)-[[3-[2-(4-isoquinolin-1-ylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]-(methylideneamino)methylidene]amino]amino]acetic acid |
| SMILES | C=N/C(=N\N(N)CC(=O)O)c1ccc(OC)c2c(C(=O)C(=O)N3CCN(c4nccc5ccccc45)CC3)c[nH]c12 |
| InChI | InChI=1S/C28H28N8O5/c1-30-26(33-36(29)16-22(37)38)19-7-8-21(41-2)23-20(15-32-24(19)23)25(39)28(40)35-13-11-34(12-14-35)27-18-6-4-3-5-17(18)9-10-31-27/h3-10,15,32H,1,11-14,16,29H2,2H3,(H,37,38)/b33-26- |
| InChIKey | SCYIQFXTUJNAKG-MKFPQRGTSA-N |
| XLogP | 1.88 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|