C26H22N6O4 — CID 5279754
1-(4-isoquinolin-1-ylpiperazin-1-yl)-2-[4-methoxy-7-(1,2,4-oxadiazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 5279754) has the molecular formula C26H22N6O4 and a molecular weight of 482.50 g/mol. Its IUPAC name is 1-(4-isoquinolin-1-ylpiperazin-1-yl)-2-[4-methoxy-7-(1,2,4-oxadiazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-isoquinolin-1-ylpiperazin-1-yl)-2-[4-methoxy-7-(1,2,4-oxadiazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5279754 |
| Molecular Formula | C26H22N6O4 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-(4-isoquinolin-1-ylpiperazin-1-yl)-2-[4-methoxy-7-(1,2,4-oxadiazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | COc1ccc(-c2ncon2)c2[nH]cc(C(=O)C(=O)N3CCN(c4nccc5ccccc45)CC3)c12 |
| InChI | InChI=1S/C26H22N6O4/c1-35-20-7-6-18(24-29-15-36-30-24)22-21(20)19(14-28-22)23(33)26(34)32-12-10-31(11-13-32)25-17-5-3-2-4-16(17)8-9-27-25/h2-9,14-15,28H,10-13H2,1H3 |
| InChIKey | OWEBOGIMCUAGSF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|