C26H25Cl3N6O2 — CID 142987607
5-(1,3-benzodioxol-5-yl)-1-(2,5-dichlorophenyl)-3-methylpyrazole;N,N'-diamino-2-(3-chlorophenyl)propanimidamide (PubChem CID 142987607) has the molecular formula C26H25Cl3N6O2 and a molecular weight of 559.89 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1-(2,5-dichlorophenyl)-3-methylpyrazole;N,N'-diamino-2-(3-chlorophenyl)propanimidamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1-(2,5-dichlorophenyl)-3-methylpyrazole;N,N'-diamino-2-(3-chlorophenyl)propanimidamide |
|---|---|
| PubChem CID | 142987607 |
| Molecular Formula | C26H25Cl3N6O2 |
| Molecular Weight | 559.89 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1-(2,5-dichlorophenyl)-3-methylpyrazole;N,N'-diamino-2-(3-chlorophenyl)propanimidamide |
| SMILES | CC(/C(=N/N)NN)c1cccc(Cl)c1.Cc1cc(-c2ccc3c(c2)OCO3)n(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C17H12Cl2N2O2.C9H13ClN4/c1-10-6-14(11-2-5-16-17(7-11)23-9-22-16)21(20-10)15-8-12(18)3-4-13(15)19;1-6(9(13-11)14-12)7-3-2-4-8(10)5-7/h2-8H,9H2,1H3;2-6H,11-12H2,1H3,(H,13,14) |
| InChIKey | TYSXMYJZRCQCQW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|