C17H29N4O2+ — CID 142989747
7-[[4-(dimethylamino)phenyl]methylcarbamoylamino]heptanoylazanium (PubChem CID 142989747) has the molecular formula C17H29N4O2+ and a molecular weight of 321.44 g/mol. Its IUPAC name is 7-[[4-(dimethylamino)phenyl]methylcarbamoylamino]heptanoylazanium.
| Compound Name | 7-[[4-(dimethylamino)phenyl]methylcarbamoylamino]heptanoylazanium |
|---|---|
| PubChem CID | 142989747 |
| Molecular Formula | C17H29N4O2+ |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 7-[[4-(dimethylamino)phenyl]methylcarbamoylamino]heptanoylazanium |
| SMILES | CN(C)c1ccc(CNC(=O)NCCCCCCC([NH3+])=O)cc1 |
| InChI | InChI=1S/C17H28N4O2/c1-21(2)15-10-8-14(9-11-15)13-20-17(23)19-12-6-4-3-5-7-16(18)22/h8-11H,3-7,12-13H2,1-2H3,(H2,18,22)(H2,19,20,23)/p+1 |
| InChIKey | LJYPAPGVAZRLBX-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|