C26H38N6O4 — CID 142990289
5-methanimidoyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine;propan-2-yl 4-methoxyazepane-1-carboxylate (PubChem CID 142990289) has the molecular formula C26H38N6O4 and a molecular weight of 498.63 g/mol. Its IUPAC name is 5-methanimidoyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine;propan-2-yl 4-methoxyazepane-1-carboxylate.
| Compound Name | 5-methanimidoyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine;propan-2-yl 4-methoxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 142990289 |
| Molecular Formula | C26H38N6O4 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 5-methanimidoyl-N-(4-morpholin-4-ylphenyl)pyrimidin-4-amine;propan-2-yl 4-methoxyazepane-1-carboxylate |
| SMILES | COC1CCCN(C(=O)OC(C)C)CC1.[H]/N=C\c1cncnc1Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H17N5O.C11H21NO3/c16-9-12-10-17-11-18-15(12)19-13-1-3-14(4-2-13)20-5-7-21-8-6-20;1-9(2)15-11(13)12-7-4-5-10(14-3)6-8-12/h1-4,9-11,16H,5-8H2,(H,17,18,19);9-10H,4-8H2,1-3H3/b16-9-; |
| InChIKey | OMMDLSRTXLKMJU-LFMIJCLESA-N |
| XLogP | 4.09 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|