C13H12N2O2S — CID 142991898
6-methylsulfanyl-2-phenoxypyridine-3-carboxamide (PubChem CID 142991898) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 6-methylsulfanyl-2-phenoxypyridine-3-carboxamide.
| Compound Name | 6-methylsulfanyl-2-phenoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 142991898 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 6-methylsulfanyl-2-phenoxypyridine-3-carboxamide |
| SMILES | CSc1ccc(C(N)=O)c(Oc2ccccc2)n1 |
| InChI | InChI=1S/C13H12N2O2S/c1-18-11-8-7-10(12(14)16)13(15-11)17-9-5-3-2-4-6-9/h2-8H,1H3,(H2,14,16) |
| InChIKey | GWRQEKASUHFTGY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |