C18H16Cl2N2O3 — CID 142992078
ethyl 2-[(3E)-3-chloropenta-1,3-dien-2-yl]-1-(4-chlorophenyl)-5-formylimidazole-4-carboxylate (PubChem CID 142992078) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is ethyl 2-[(3E)-3-chloropenta-1,3-dien-2-yl]-1-(4-chlorophenyl)-5-formylimidazole-4-carboxylate.
| Compound Name | ethyl 2-[(3E)-3-chloropenta-1,3-dien-2-yl]-1-(4-chlorophenyl)-5-formylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 142992078 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | ethyl 2-[(3E)-3-chloropenta-1,3-dien-2-yl]-1-(4-chlorophenyl)-5-formylimidazole-4-carboxylate |
| SMILES | C=C(/C(Cl)=C\C)c1nc(C(=O)OCC)c(C=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-4-14(20)11(3)17-21-16(18(24)25-5-2)15(10-23)22(17)13-8-6-12(19)7-9-13/h4,6-10H,3,5H2,1-2H3/b14-4+ |
| InChIKey | BHPQYUFDZJJTOF-LNKIKWGQSA-N |
| XLogP | 4.67 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|