C22H29BrCl2N2O2 — CID 143066911
ethane;ethyl 5-bromo-2-[(2E,4Z)-2-chlorohexa-2,4-dienyl]-1-(4-chlorophenyl)imidazole-4-carboxylate (PubChem CID 143066911) has the molecular formula C22H29BrCl2N2O2 and a molecular weight of 504.30 g/mol. Its IUPAC name is ethane;ethyl 5-bromo-2-[(2E,4Z)-2-chlorohexa-2,4-dienyl]-1-(4-chlorophenyl)imidazole-4-carboxylate.
| Compound Name | ethane;ethyl 5-bromo-2-[(2E,4Z)-2-chlorohexa-2,4-dienyl]-1-(4-chlorophenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 143066911 |
| Molecular Formula | C22H29BrCl2N2O2 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | ethane;ethyl 5-bromo-2-[(2E,4Z)-2-chlorohexa-2,4-dienyl]-1-(4-chlorophenyl)imidazole-4-carboxylate |
| SMILES | C/C=C\C=C(\Cl)Cc1nc(C(=O)OCC)c(Br)n1-c1ccc(Cl)cc1.CC.CC |
| InChI | InChI=1S/C18H17BrCl2N2O2.2C2H6/c1-3-5-6-13(21)11-15-22-16(18(24)25-4-2)17(19)23(15)14-9-7-12(20)8-10-14;2*1-2/h3,5-10H,4,11H2,1-2H3;2*1-2H3/b5-3-,13-6+;; |
| InChIKey | BSHKXRHYALTSQG-JEFMXPAHSA-N |
| XLogP | 7.76 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|