C20H23ClN2O3 — CID 142992081
ethyl 1-(2-chlorophenyl)-5-[(E)-2-methoxyethenyl]-2-[(Z)-pent-3-en-2-yl]imidazole-4-carboxylate (PubChem CID 142992081) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is ethyl 1-(2-chlorophenyl)-5-[(E)-2-methoxyethenyl]-2-[(Z)-pent-3-en-2-yl]imidazole-4-carboxylate.
| Compound Name | ethyl 1-(2-chlorophenyl)-5-[(E)-2-methoxyethenyl]-2-[(Z)-pent-3-en-2-yl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 142992081 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 1-(2-chlorophenyl)-5-[(E)-2-methoxyethenyl]-2-[(Z)-pent-3-en-2-yl]imidazole-4-carboxylate |
| SMILES | C/C=C\C(C)c1nc(C(=O)OCC)c(/C=C/OC)n1-c1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN2O3/c1-5-9-14(3)19-22-18(20(24)26-6-2)17(12-13-25-4)23(19)16-11-8-7-10-15(16)21/h5,7-14H,6H2,1-4H3/b9-5-,13-12+ |
| InChIKey | AARJXHBITTZWNX-CBWXWMMMSA-N |
| XLogP | 5.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|