C16H15ClF2N2O3 — CID 140938976
ethyl 5-chloro-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate (PubChem CID 140938976) has the molecular formula C16H15ClF2N2O3 and a molecular weight of 356.76 g/mol. Its IUPAC name is ethyl 5-chloro-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-chloro-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 140938976 |
| Molecular Formula | C16H15ClF2N2O3 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | ethyl 5-chloro-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(Cc2c(F)cccc2F)c(Cl)c1C=COC |
| InChI | InChI=1S/C16H15ClF2N2O3/c1-3-24-16(22)14-10(7-8-23-2)15(17)21(20-14)9-11-12(18)5-4-6-13(11)19/h4-8H,3,9H2,1-2H3 |
| InChIKey | MHPOVRHLZKUQSJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|