C16H16FO3PS — CID 142992237
3-(3-fluoro-5-phosphanylphenyl)-3-(4-methylsulfonylphenyl)propanal (PubChem CID 142992237) has the molecular formula C16H16FO3PS and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-(3-fluoro-5-phosphanylphenyl)-3-(4-methylsulfonylphenyl)propanal.
| Compound Name | 3-(3-fluoro-5-phosphanylphenyl)-3-(4-methylsulfonylphenyl)propanal |
|---|---|
| PubChem CID | 142992237 |
| Molecular Formula | C16H16FO3PS |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-(3-fluoro-5-phosphanylphenyl)-3-(4-methylsulfonylphenyl)propanal |
| SMILES | CS(=O)(=O)c1ccc(C(CC=O)c2cc(F)cc(P)c2)cc1 |
| InChI | InChI=1S/C16H16FO3PS/c1-22(19,20)15-4-2-11(3-5-15)16(6-7-18)12-8-13(17)10-14(21)9-12/h2-5,7-10,16H,6,21H2,1H3 |
| InChIKey | DVCTUNYVNSLFBI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|