C21H25ClN2O2 — CID 142993466
6-chloro-3-[1-[(E)-ethylideneamino]oxyethenyl]-4-[(E)-oct-4-en-4-yl]-1H-quinolin-2-one (PubChem CID 142993466) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 6-chloro-3-[1-[(E)-ethylideneamino]oxyethenyl]-4-[(E)-oct-4-en-4-yl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[1-[(E)-ethylideneamino]oxyethenyl]-4-[(E)-oct-4-en-4-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142993466 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 6-chloro-3-[1-[(E)-ethylideneamino]oxyethenyl]-4-[(E)-oct-4-en-4-yl]-1H-quinolin-2-one |
| SMILES | C=C(O/N=C/C)c1c(/C(=C/CCC)CCC)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C21H25ClN2O2/c1-5-8-10-15(9-6-2)20-17-13-16(22)11-12-18(17)24-21(25)19(20)14(4)26-23-7-3/h7,10-13H,4-6,8-9H2,1-3H3,(H,24,25)/b15-10+,23-7+ |
| InChIKey | UIHUEBAUOYULNH-YSCOKPJHSA-N |
| XLogP | 6.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|