C13H16ClN4+ — CID 142994509
2-chloro-4-N-(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,5-diamine (PubChem CID 142994509) has the molecular formula C13H16ClN4+ and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-chloro-4-N-(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,5-diamine.
| Compound Name | 2-chloro-4-N-(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,5-diamine |
|---|---|
| PubChem CID | 142994509 |
| Molecular Formula | C13H16ClN4+ |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-chloro-4-N-(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,5-diamine |
| SMILES | Cc1cc(C)c(Nc2nc(Cl)[nH+]cc2N)c(C)c1 |
| InChI | InChI=1S/C13H15ClN4/c1-7-4-8(2)11(9(3)5-7)17-12-10(15)6-16-13(14)18-12/h4-6H,15H2,1-3H3,(H,16,17,18)/p+1 |
| InChIKey | UFPFLKXUYOCGMX-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |