C22H44N4 — CID 142994746
(3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide;buta-1,3-diene;ethane (PubChem CID 142994746) has the molecular formula C22H44N4 and a molecular weight of 364.62 g/mol. Its IUPAC name is (3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide;buta-1,3-diene;ethane.
| Compound Name | (3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide;buta-1,3-diene;ethane |
|---|---|
| PubChem CID | 142994746 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | (3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide;buta-1,3-diene;ethane |
| SMILES | C=CC=C.CC.CC.[H]/N=C(\C/C=C\C(N)=C(/C)N(C)C)N(C)/C(C)=C/C |
| InChI | InChI=1S/C14H26N4.C4H6.2C2H6/c1-7-11(2)18(6)14(16)10-8-9-13(15)12(3)17(4)5;1-3-4-2;2*1-2/h7-9,16H,10,15H2,1-6H3;3-4H,1-2H2;2*1-2H3/b9-8-,11-7+,13-12-,16-14+;;; |
| InChIKey | YETGYTSMHZGZDD-KDXPADAVSA-N |
| XLogP | 5.93 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|