C14H26N4 — CID 142994747
(3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide (PubChem CID 142994747) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is (3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide.
| Compound Name | (3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide |
|---|---|
| PubChem CID | 142994747 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | (3Z,5Z)-5-amino-N-[(E)-but-2-en-2-yl]-6-(dimethylamino)-N-methylhepta-3,5-dienimidamide |
| SMILES | [H]/N=C(\C/C=C\C(N)=C(/C)N(C)C)N(C)/C(C)=C/C |
| InChI | InChI=1S/C14H26N4/c1-7-11(2)18(6)14(16)10-8-9-13(15)12(3)17(4)5/h7-9,16H,10,15H2,1-6H3/b9-8-,11-7+,13-12-,16-14+ |
| InChIKey | DDTZEFCULSFXOX-ZJZRLJSJSA-N |
| XLogP | 2.52 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|