C11H18N4 — CID 166079276
(4Z,6E)-7-amino-N-methanimidoyl-N-methylnona-4,6,8-trienimidamide (PubChem CID 166079276) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is (4Z,6E)-7-amino-N-methanimidoyl-N-methylnona-4,6,8-trienimidamide.
| Compound Name | (4Z,6E)-7-amino-N-methanimidoyl-N-methylnona-4,6,8-trienimidamide |
|---|---|
| PubChem CID | 166079276 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (4Z,6E)-7-amino-N-methanimidoyl-N-methylnona-4,6,8-trienimidamide |
| SMILES | [H]/N=C/N(C)/C(CC/C=C\C=C(\N)C=C)=N/[H] |
| InChI | InChI=1S/C11H18N4/c1-3-10(13)7-5-4-6-8-11(14)15(2)9-12/h3-5,7,9,12,14H,1,6,8,13H2,2H3/b5-4-,10-7+,12-9+,14-11+ |
| InChIKey | UQOTUJCYMINQFM-QAWMIOIWSA-N |
| XLogP | 1.87 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|