C9H8N2O — CID 142995211
3-methyl-7H-1,7-naphthyridin-6-one (PubChem CID 142995211) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 3-methyl-7H-1,7-naphthyridin-6-one.
| Compound Name | 3-methyl-7H-1,7-naphthyridin-6-one |
|---|---|
| PubChem CID | 142995211 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 3-methyl-7H-1,7-naphthyridin-6-one |
| SMILES | Cc1cnc2c[nH]c(=O)cc2c1 |
| InChI | InChI=1S/C9H8N2O/c1-6-2-7-3-9(12)11-5-8(7)10-4-6/h2-5H,1H3,(H,11,12) |
| InChIKey | WMBRUUOPQVZPMS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |