C21H28N6 — CID 142996606
N-[5-butyl-6-(imidazol-1-ylmethyl)-4H-pyrimidin-3-yl]-N'-methylcyclohepta-1,4,6-triene-1-carboximidamide (PubChem CID 142996606) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is N-[5-butyl-6-(imidazol-1-ylmethyl)-4H-pyrimidin-3-yl]-N'-methylcyclohepta-1,4,6-triene-1-carboximidamide.
| Compound Name | N-[5-butyl-6-(imidazol-1-ylmethyl)-4H-pyrimidin-3-yl]-N'-methylcyclohepta-1,4,6-triene-1-carboximidamide |
|---|---|
| PubChem CID | 142996606 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | N-[5-butyl-6-(imidazol-1-ylmethyl)-4H-pyrimidin-3-yl]-N'-methylcyclohepta-1,4,6-triene-1-carboximidamide |
| SMILES | CCCCC1=C(Cn2ccnc2)N=CN(N/C(=N/C)C2=CCC=CC=C2)C1 |
| InChI | InChI=1S/C21H28N6/c1-3-4-9-19-14-27(17-24-20(19)15-26-13-12-23-16-26)25-21(22-2)18-10-7-5-6-8-11-18/h5-7,10-13,16-17H,3-4,8-9,14-15H2,1-2H3,(H,22,25) |
| InChIKey | SEDZUOUBBXHHNF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|