C12H15FN6 — CID 142996669
3-ethanimidoyl-5-(2-fluoroethyl)-6-(imidazol-1-ylmethyl)pyrimidin-4-imine (PubChem CID 142996669) has the molecular formula C12H15FN6 and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-ethanimidoyl-5-(2-fluoroethyl)-6-(imidazol-1-ylmethyl)pyrimidin-4-imine.
| Compound Name | 3-ethanimidoyl-5-(2-fluoroethyl)-6-(imidazol-1-ylmethyl)pyrimidin-4-imine |
|---|---|
| PubChem CID | 142996669 |
| Molecular Formula | C12H15FN6 |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-ethanimidoyl-5-(2-fluoroethyl)-6-(imidazol-1-ylmethyl)pyrimidin-4-imine |
| SMILES | [H]/N=c1/c(CCF)c(Cn2ccnc2)ncn1/C(C)=N/[H] |
| InChI | InChI=1S/C12H15FN6/c1-9(14)19-8-17-11(6-18-5-4-16-7-18)10(2-3-13)12(19)15/h4-5,7-8,14-15H,2-3,6H2,1H3/b14-9+,15-12- |
| InChIKey | AQGUJRLQDOERQC-QRHUXVGTSA-N |
| XLogP | 0.96 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|