C15H22N2O5 — CID 142997317
5-[(3-methylbenzimidazol-4-yl)oxymethoxy]hexane-2,3,4-triol (PubChem CID 142997317) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-[(3-methylbenzimidazol-4-yl)oxymethoxy]hexane-2,3,4-triol.
| Compound Name | 5-[(3-methylbenzimidazol-4-yl)oxymethoxy]hexane-2,3,4-triol |
|---|---|
| PubChem CID | 142997317 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-[(3-methylbenzimidazol-4-yl)oxymethoxy]hexane-2,3,4-triol |
| SMILES | CC(O)C(O)C(O)C(C)OCOc1cccc2ncn(C)c12 |
| InChI | InChI=1S/C15H22N2O5/c1-9(18)14(19)15(20)10(2)21-8-22-12-6-4-5-11-13(12)17(3)7-16-11/h4-7,9-10,14-15,18-20H,8H2,1-3H3 |
| InChIKey | JJBMKMITUWZSKE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|