About 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane
4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane (PubChem CID 142997691) has the molecular formula C16H22N2O2S
and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane.
Molecular Properties
| Compound Name | 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane |
| PubChem CID | 142997691 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane |
| SMILES | C=C(N)CN1C(=O)C(CC(C)=O)Sc2ccccc21.CC |
| InChI | InChI=1S/C14H16N2O2S.C2H6/c1-9(15)8-16-11-5-3-4-6-12(11)19-13(14(16)18)7-10(2)17;1-2/h3-6,13H,1,7-8,15H2,2H3;1-2H3 |
| InChIKey | GDBNFBIONWYXJA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane?
The IUPAC name of 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane (CID 142997691) is 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane.
What is the SMILES notation for 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane?
The canonical SMILES for 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane is C=C(N)CN1C(=O)C(CC(C)=O)Sc2ccccc21.CC.
What is the InChIKey of 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane?
The InChIKey is GDBNFBIONWYXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S.C2H6/c1-9(15)8-16-11-5-3-4-6-12(11)19-13(14(16)18)7-10(2)17;1-2/h3-6,13H,1,7-8,15H2,2H3;1-2H3.
What are the key properties of 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane?
4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane has a molecular weight of 306.43 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoprop-2-enyl)-2-(2-oxopropyl)-1,4-benzothiazin-3-one;ethane is sourced from PubChem (CID 142997691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).