C16H22ClN — CID 143001724
3-(4-chloro-2-prop-1-en-2-ylphenyl)-2-methyl-N-[(Z)-prop-1-enyl]propan-1-amine (PubChem CID 143001724) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 3-(4-chloro-2-prop-1-en-2-ylphenyl)-2-methyl-N-[(Z)-prop-1-enyl]propan-1-amine.
| Compound Name | 3-(4-chloro-2-prop-1-en-2-ylphenyl)-2-methyl-N-[(Z)-prop-1-enyl]propan-1-amine |
|---|---|
| PubChem CID | 143001724 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-(4-chloro-2-prop-1-en-2-ylphenyl)-2-methyl-N-[(Z)-prop-1-enyl]propan-1-amine |
| SMILES | C=C(C)c1cc(Cl)ccc1CC(C)CN/C=C\C |
| InChI | InChI=1S/C16H22ClN/c1-5-8-18-11-13(4)9-14-6-7-15(17)10-16(14)12(2)3/h5-8,10,13,18H,2,9,11H2,1,3-4H3/b8-5- |
| InChIKey | LWFZRSLAMHXQBY-YVMONPNESA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |