C27H34Cl2N2 — CID 142078790
N-[(2,4-dichlorophenyl)methyl]-N-(4-methylphenyl)-2-(2-methylprop-2-enyl)-N'-[(E)-prop-1-enyl]-2-prop-2-enylpropane-1,3-diamine (PubChem CID 142078790) has the molecular formula C27H34Cl2N2 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-(4-methylphenyl)-2-(2-methylprop-2-enyl)-N'-[(E)-prop-1-enyl]-2-prop-2-enylpropane-1,3-diamine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-(4-methylphenyl)-2-(2-methylprop-2-enyl)-N'-[(E)-prop-1-enyl]-2-prop-2-enylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142078790 |
| Molecular Formula | C27H34Cl2N2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-(4-methylphenyl)-2-(2-methylprop-2-enyl)-N'-[(E)-prop-1-enyl]-2-prop-2-enylpropane-1,3-diamine |
| SMILES | C=CCC(CN/C=C/C)(CC(=C)C)CN(Cc1ccc(Cl)cc1Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H34Cl2N2/c1-6-14-27(17-21(3)4,19-30-15-7-2)20-31(25-12-8-22(5)9-13-25)18-23-10-11-24(28)16-26(23)29/h6-13,15-16,30H,1,3,14,17-20H2,2,4-5H3/b15-7+ |
| InChIKey | HUTPEYKSIKIUDV-VIZOYTHASA-N |
| XLogP | 7.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|