C22H24Cl2N2O4 — CID 142078805
3-[[(2,4-dichlorophenyl)methyl-(methylcarbamoyl)amino]methyl]-3-(4-methylphenyl)-5-oxopentanoic acid (PubChem CID 142078805) has the molecular formula C22H24Cl2N2O4 and a molecular weight of 451.35 g/mol. Its IUPAC name is 3-[[(2,4-dichlorophenyl)methyl-(methylcarbamoyl)amino]methyl]-3-(4-methylphenyl)-5-oxopentanoic acid.
| Compound Name | 3-[[(2,4-dichlorophenyl)methyl-(methylcarbamoyl)amino]methyl]-3-(4-methylphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142078805 |
| Molecular Formula | C22H24Cl2N2O4 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[[(2,4-dichlorophenyl)methyl-(methylcarbamoyl)amino]methyl]-3-(4-methylphenyl)-5-oxopentanoic acid |
| SMILES | CNC(=O)N(Cc1ccc(Cl)cc1Cl)CC(CC=O)(CC(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O4/c1-15-3-6-17(7-4-15)22(9-10-27,12-20(28)29)14-26(21(30)25-2)13-16-5-8-18(23)11-19(16)24/h3-8,10-11H,9,12-14H2,1-2H3,(H,25,30)(H,28,29) |
| InChIKey | XFCPZNQHDCKZSA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|