C24H28Cl2N2O2 — CID 142078683
N-[2-[[N-[(2,4-dichlorophenyl)methyl]-4-methylanilino]methyl]-4-methyl-2-(2-oxoethyl)pent-4-enyl]formamide (PubChem CID 142078683) has the molecular formula C24H28Cl2N2O2 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-[2-[[N-[(2,4-dichlorophenyl)methyl]-4-methylanilino]methyl]-4-methyl-2-(2-oxoethyl)pent-4-enyl]formamide.
| Compound Name | N-[2-[[N-[(2,4-dichlorophenyl)methyl]-4-methylanilino]methyl]-4-methyl-2-(2-oxoethyl)pent-4-enyl]formamide |
|---|---|
| PubChem CID | 142078683 |
| Molecular Formula | C24H28Cl2N2O2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[2-[[N-[(2,4-dichlorophenyl)methyl]-4-methylanilino]methyl]-4-methyl-2-(2-oxoethyl)pent-4-enyl]formamide |
| SMILES | C=C(C)CC(CC=O)(CNC=O)CN(Cc1ccc(Cl)cc1Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28Cl2N2O2/c1-18(2)13-24(10-11-29,15-27-17-30)16-28(22-8-4-19(3)5-9-22)14-20-6-7-21(25)12-23(20)26/h4-9,11-12,17H,1,10,13-16H2,2-3H3,(H,27,30) |
| InChIKey | OEAHWEBVSQBCAL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|