C24H29Cl2N — CID 142078721
N-[4-(2,4-dichlorophenyl)but-1-en-2-yl]-N-(2-ethylpent-4-enyl)-4-methylaniline (PubChem CID 142078721) has the molecular formula C24H29Cl2N and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)but-1-en-2-yl]-N-(2-ethylpent-4-enyl)-4-methylaniline.
| Compound Name | N-[4-(2,4-dichlorophenyl)but-1-en-2-yl]-N-(2-ethylpent-4-enyl)-4-methylaniline |
|---|---|
| PubChem CID | 142078721 |
| Molecular Formula | C24H29Cl2N |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)but-1-en-2-yl]-N-(2-ethylpent-4-enyl)-4-methylaniline |
| SMILES | C=CCC(CC)CN(C(=C)CCc1ccc(Cl)cc1Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H29Cl2N/c1-5-7-20(6-2)17-27(23-14-8-18(3)9-15-23)19(4)10-11-21-12-13-22(25)16-24(21)26/h5,8-9,12-16,20H,1,4,6-7,10-11,17H2,2-3H3 |
| InChIKey | KAHWJWDGSKOYMI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|