C14H17Cl2NO3 — CID 142078766
3-[[(2,4-dichlorophenyl)methyl-formylamino]methyl]pentanoic acid (PubChem CID 142078766) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-[[(2,4-dichlorophenyl)methyl-formylamino]methyl]pentanoic acid.
| Compound Name | 3-[[(2,4-dichlorophenyl)methyl-formylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 142078766 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-[[(2,4-dichlorophenyl)methyl-formylamino]methyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)CN(C=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO3/c1-2-10(5-14(19)20)7-17(9-18)8-11-3-4-12(15)6-13(11)16/h3-4,6,9-10H,2,5,7-8H2,1H3,(H,19,20) |
| InChIKey | DDUVPZOZAYMTRR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|