C23H36O4 — CID 143004420
2,3-dimethoxy-5-methyl-6-[(3Z)-2,4,8-trimethylnona-3,7-dien-2-yl]cyclohexa-2,5-diene-1,4-dione;ethane (PubChem CID 143004420) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(3Z)-2,4,8-trimethylnona-3,7-dien-2-yl]cyclohexa-2,5-diene-1,4-dione;ethane.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(3Z)-2,4,8-trimethylnona-3,7-dien-2-yl]cyclohexa-2,5-diene-1,4-dione;ethane |
|---|---|
| PubChem CID | 143004420 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(3Z)-2,4,8-trimethylnona-3,7-dien-2-yl]cyclohexa-2,5-diene-1,4-dione;ethane |
| SMILES | CC.COC1=C(OC)C(=O)C(C(C)(C)/C=C(/C)CCC=C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C21H30O4.C2H6/c1-13(2)10-9-11-14(3)12-21(5,6)16-15(4)17(22)19(24-7)20(25-8)18(16)23;1-2/h10,12H,9,11H2,1-8H3;1-2H3/b14-12-; |
| InChIKey | WFHVGUKLGUSNHG-CTMPBGLUSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|