C39H52F2N4O4 — CID 143004884
1-N-[(2R,3S)-1-[1-[benzyl(formyl)amino]pentan-2-ylamino]-5-(3,5-difluorophenyl)-2-hydroxypentan-3-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 143004884) has the molecular formula C39H52F2N4O4 and a molecular weight of 678.87 g/mol. Its IUPAC name is 1-N-[(2R,3S)-1-[1-[benzyl(formyl)amino]pentan-2-ylamino]-5-(3,5-difluorophenyl)-2-hydroxypentan-3-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2R,3S)-1-[1-[benzyl(formyl)amino]pentan-2-ylamino]-5-(3,5-difluorophenyl)-2-hydroxypentan-3-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 143004884 |
| Molecular Formula | C39H52F2N4O4 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | 1-N-[(2R,3S)-1-[1-[benzyl(formyl)amino]pentan-2-ylamino]-5-(3,5-difluorophenyl)-2-hydroxypentan-3-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCC(CN(C=O)Cc1ccccc1)NC[C@@H](O)[C@H](CCc1cc(F)cc(F)c1)NC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C39H52F2N4O4/c1-5-11-35(26-44(27-46)25-29-12-9-8-10-13-29)42-24-37(47)36(15-14-30-20-33(40)23-34(41)21-30)43-38(48)31-18-28(4)19-32(22-31)39(49)45(16-6-2)17-7-3/h8-10,12-13,18-23,27,35-37,42,47H,5-7,11,14-17,24-26H2,1-4H3,(H,43,48)/t35?,36-,37+/m0/s1 |
| InChIKey | KAICZGQWUQECIV-AYZHLZKXSA-N |
| XLogP | 6.04 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|