C11H19NO4 — CID 143005047
ethane;6-nitrocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 143005047) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is ethane;6-nitrocyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | ethane;6-nitrocyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 143005047 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | ethane;6-nitrocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC.CC.O=C(O)C1=CCCC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO4.2C2H6/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-2/h3-4H,1-2H2,(H,9,10);2*1-2H3 |
| InChIKey | KIRQVXQOPLAXFZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|