C16H24N2O4 — CID 143006393
2-[(5aS,9aS)-1,4-dioxo-4a,5,5a,6,7,8,9,9a-octahydro-3H-pyrimido[1,6-a]indol-2-yl]pentanoic acid (PubChem CID 143006393) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[(5aS,9aS)-1,4-dioxo-4a,5,5a,6,7,8,9,9a-octahydro-3H-pyrimido[1,6-a]indol-2-yl]pentanoic acid.
| Compound Name | 2-[(5aS,9aS)-1,4-dioxo-4a,5,5a,6,7,8,9,9a-octahydro-3H-pyrimido[1,6-a]indol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 143006393 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[(5aS,9aS)-1,4-dioxo-4a,5,5a,6,7,8,9,9a-octahydro-3H-pyrimido[1,6-a]indol-2-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CC(=O)C2C[C@@H]3CCCC[C@@H]3N2C1=O |
| InChI | InChI=1S/C16H24N2O4/c1-2-5-12(15(20)21)17-9-14(19)13-8-10-6-3-4-7-11(10)18(13)16(17)22/h10-13H,2-9H2,1H3,(H,20,21)/t10-,11-,12?,13?/m0/s1 |
| InChIKey | PQDTULQQDIRTBS-ZSVAQUKISA-N |
| XLogP | 1.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |