C27H39FN6O3 — CID 143006920
1-ethyltriazole;N-[[3-[(3E,5Z,8Z,10E)-5-fluoro-6,7-dimethyl-10-(methylaminomethyl)trideca-1,3,5,8,10,12-hexaen-3-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 143006920) has the molecular formula C27H39FN6O3 and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-ethyltriazole;N-[[3-[(3E,5Z,8Z,10E)-5-fluoro-6,7-dimethyl-10-(methylaminomethyl)trideca-1,3,5,8,10,12-hexaen-3-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 1-ethyltriazole;N-[[3-[(3E,5Z,8Z,10E)-5-fluoro-6,7-dimethyl-10-(methylaminomethyl)trideca-1,3,5,8,10,12-hexaen-3-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143006920 |
| Molecular Formula | C27H39FN6O3 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 1-ethyltriazole;N-[[3-[(3E,5Z,8Z,10E)-5-fluoro-6,7-dimethyl-10-(methylaminomethyl)trideca-1,3,5,8,10,12-hexaen-3-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | C=C/C=C(\C=C/C(C)/C(C)=C(F)/C=C(\C=C)N1CC(CNC(C)=O)OC1=O)CNC.CCn1ccnn1 |
| InChI | InChI=1S/C23H32FN3O3.C4H7N3/c1-7-9-19(13-25-6)11-10-16(3)17(4)22(24)12-20(8-2)27-15-21(30-23(27)29)14-26-18(5)28;1-2-7-4-3-5-6-7/h7-12,16,21,25H,1-2,13-15H2,3-6H3,(H,26,28);3-4H,2H2,1H3/b11-10-,19-9+,20-12+,22-17-; |
| InChIKey | GUZSAWZLQWIYKD-UTZGTCOTSA-N |
| XLogP | 4.08 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|