C25H35FN6O3 — CID 143367750
N-[[(5S)-3-[4-[(3Z,5E)-5-[3-(aminodiazenyl)propylamino]octa-1,3,5,7-tetraen-2-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane (PubChem CID 143367750) has the molecular formula C25H35FN6O3 and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(3Z,5E)-5-[3-(aminodiazenyl)propylamino]octa-1,3,5,7-tetraen-2-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane.
| Compound Name | N-[[(5S)-3-[4-[(3Z,5E)-5-[3-(aminodiazenyl)propylamino]octa-1,3,5,7-tetraen-2-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane |
|---|---|
| PubChem CID | 143367750 |
| Molecular Formula | C25H35FN6O3 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | N-[[(5S)-3-[4-[(3Z,5E)-5-[3-(aminodiazenyl)propylamino]octa-1,3,5,7-tetraen-2-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane |
| SMILES | C=C/C=C(\C=C/C(=C)c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F)NCCC/N=N/N.CC |
| InChI | InChI=1S/C23H29FN6O3.C2H6/c1-4-6-18(26-11-5-12-28-29-25)8-7-16(2)21-10-9-19(13-22(21)24)30-15-20(33-23(30)32)14-27-17(3)31;1-2/h4,6-10,13,20,26H,1-2,5,11-12,14-15H2,3H3,(H2,25,28)(H,27,31);1-2H3/b8-7-,18-6+;/t20-;/m0./s1 |
| InChIKey | CGYHUJOANRQPGK-LVSUSCRNSA-N |
| XLogP | 4.26 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|