C15H19FN6O3 — CID 89174951
N-[[(5S)-3-[4-[(Z)-N-amino-N-methyl-N'-(methylideneamino)carbamimidoyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 89174951) has the molecular formula C15H19FN6O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(Z)-N-amino-N-methyl-N'-(methylideneamino)carbamimidoyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[(Z)-N-amino-N-methyl-N'-(methylideneamino)carbamimidoyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 89174951 |
| Molecular Formula | C15H19FN6O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[[(5S)-3-[4-[(Z)-N-amino-N-methyl-N'-(methylideneamino)carbamimidoyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | C=N/N=C(/c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F)N(C)N |
| InChI | InChI=1S/C15H19FN6O3/c1-9(23)19-7-11-8-22(15(24)25-11)10-4-5-12(13(16)6-10)14(20-18-2)21(3)17/h4-6,11H,2,7-8,17H2,1,3H3,(H,19,23)/b20-14-/t11-/m0/s1 |
| InChIKey | CDUXEFPUCSLOPJ-CJJSWDBDSA-N |
| XLogP | 0.45 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|