C24H33FN6O3S — CID 143007005
N-[[3-[4-[4-[1-[(Z)-[amino(hydrazinyl)methylidene]amino]ethylsulfanylmethyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane (PubChem CID 143007005) has the molecular formula C24H33FN6O3S and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[[3-[4-[4-[1-[(Z)-[amino(hydrazinyl)methylidene]amino]ethylsulfanylmethyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane.
| Compound Name | N-[[3-[4-[4-[1-[(Z)-[amino(hydrazinyl)methylidene]amino]ethylsulfanylmethyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane |
|---|---|
| PubChem CID | 143007005 |
| Molecular Formula | C24H33FN6O3S |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N-[[3-[4-[4-[1-[(Z)-[amino(hydrazinyl)methylidene]amino]ethylsulfanylmethyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;ethane |
| SMILES | CC.CC(=O)NCC1CN(c2ccc(-c3ccc(CSC(C)/N=C(/N)NN)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H27FN6O3S.C2H6/c1-13(30)26-10-18-11-29(22(31)32-18)17-7-8-19(20(23)9-17)16-5-3-15(4-6-16)12-33-14(2)27-21(24)28-25;1-2/h3-9,14,18H,10-12,25H2,1-2H3,(H,26,30)(H3,24,27,28);1-2H3 |
| InChIKey | JYHCCGLRXMQAKN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|