C20H26N4O — CID 143007958
(1R)-1-[3-[2-[(5-methanimidoylpyrimidin-4-yl)amino]ethyl]cyclobutyl]-3-phenylpropan-1-ol (PubChem CID 143007958) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is (1R)-1-[3-[2-[(5-methanimidoylpyrimidin-4-yl)amino]ethyl]cyclobutyl]-3-phenylpropan-1-ol.
| Compound Name | (1R)-1-[3-[2-[(5-methanimidoylpyrimidin-4-yl)amino]ethyl]cyclobutyl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 143007958 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R)-1-[3-[2-[(5-methanimidoylpyrimidin-4-yl)amino]ethyl]cyclobutyl]-3-phenylpropan-1-ol |
| SMILES | [H]/N=C/c1cncnc1NCCC1CC([C@H](O)CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H26N4O/c21-12-18-13-22-14-24-20(18)23-9-8-16-10-17(11-16)19(25)7-6-15-4-2-1-3-5-15/h1-5,12-14,16-17,19,21,25H,6-11H2,(H,22,23,24)/b21-12+/t16?,17?,19-/m1/s1 |
| InChIKey | BTWIGHNSGMSCHG-OXVQGQNUSA-N |
| XLogP | 3.30 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|