C15H21NO2 — CID 143007968
cyclohepta-1,4,6-trien-1-ylmethyl N-cyclohexylcarbamate (PubChem CID 143007968) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is cyclohepta-1,4,6-trien-1-ylmethyl N-cyclohexylcarbamate.
| Compound Name | cyclohepta-1,4,6-trien-1-ylmethyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 143007968 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | cyclohepta-1,4,6-trien-1-ylmethyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OCC1=CCC=CC=C1 |
| InChI | InChI=1S/C15H21NO2/c17-15(16-14-10-6-3-7-11-14)18-12-13-8-4-1-2-5-9-13/h1-2,4,8-9,14H,3,5-7,10-12H2,(H,16,17) |
| InChIKey | GOSILEYZPIQICH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |