C29H42N4O5 — CID 143014793
4-[(1S,7aR)-4-[2-[(2-amino-4-nitrophenyl)hydrazinylidene]ethyl]-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohexyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanoic acid (PubChem CID 143014793) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is 4-[(1S,7aR)-4-[2-[(2-amino-4-nitrophenyl)hydrazinylidene]ethyl]-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohexyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanoic acid.
| Compound Name | 4-[(1S,7aR)-4-[2-[(2-amino-4-nitrophenyl)hydrazinylidene]ethyl]-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohexyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanoic acid |
|---|---|
| PubChem CID | 143014793 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 4-[(1S,7aR)-4-[2-[(2-amino-4-nitrophenyl)hydrazinylidene]ethyl]-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohexyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanoic acid |
| SMILES | C[C@]1(C2CC[C@@]3(C)C(CC[C@@H]3CCCC(=O)O)C2CC=NNc2ccc([N+](=O)[O-])cc2N)CCCCC1=O |
| InChI | InChI=1S/C29H42N4O5/c1-28-16-13-23(29(2)15-4-3-7-26(29)34)21(22(28)11-9-19(28)6-5-8-27(35)36)14-17-31-32-25-12-10-20(33(37)38)18-24(25)30/h10,12,17-19,21-23,32H,3-9,11,13-16,30H2,1-2H3,(H,35,36)/t19-,21?,22?,23?,28+,29+/m0/s1 |
| InChIKey | NEZPVBUCHAPPBR-MKMNNKPBSA-N |
| XLogP | 6.43 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|