C21H24N4O2 — CID 143015532
N-benzyl-3-tert-butyl-1-(4-methylphenyl)-4-nitropyrazol-5-amine (PubChem CID 143015532) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-benzyl-3-tert-butyl-1-(4-methylphenyl)-4-nitropyrazol-5-amine.
| Compound Name | N-benzyl-3-tert-butyl-1-(4-methylphenyl)-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 143015532 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-benzyl-3-tert-butyl-1-(4-methylphenyl)-4-nitropyrazol-5-amine |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)c([N+](=O)[O-])c2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-15-10-12-17(13-11-15)24-20(22-14-16-8-6-5-7-9-16)18(25(26)27)19(23-24)21(2,3)4/h5-13,22H,14H2,1-4H3 |
| InChIKey | IMMFMZZYMPUGHH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|