C19H19N5O4S — CID 143015859
S-[5-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-1,3-benzodioxol-4-yl]thiohydroxylamine (PubChem CID 143015859) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is S-[5-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-1,3-benzodioxol-4-yl]thiohydroxylamine.
| Compound Name | S-[5-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-1,3-benzodioxol-4-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 143015859 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | S-[5-[[2-(3,4-dimethoxyanilino)pyrimidin-4-yl]amino]-1,3-benzodioxol-4-yl]thiohydroxylamine |
| SMILES | COc1ccc(Nc2nccc(Nc3ccc4c(c3SN)OCO4)n2)cc1OC |
| InChI | InChI=1S/C19H19N5O4S/c1-25-13-5-3-11(9-15(13)26-2)22-19-21-8-7-16(24-19)23-12-4-6-14-17(18(12)29-20)28-10-27-14/h3-9H,10,20H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | ZCXUDGOAAVXFDL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|