C26H34N8O3 — CID 143015958
N-[4-[(Z)-cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-1-[[(2-methylpropan-2-yl)oxyamino]oxymethyl]pyrrolidine-3-carboxamide (PubChem CID 143015958) has the molecular formula C26H34N8O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[4-[(Z)-cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-1-[[(2-methylpropan-2-yl)oxyamino]oxymethyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[4-[(Z)-cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-1-[[(2-methylpropan-2-yl)oxyamino]oxymethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 143015958 |
| Molecular Formula | C26H34N8O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | N-[4-[(Z)-cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-1-[[(2-methylpropan-2-yl)oxyamino]oxymethyl]pyrrolidine-3-carboxamide |
| SMILES | CCN1/C(=C(\C#N)c2nc(NC(=O)C3CCN(CONOC(C)(C)C)C3)ncc2C)Nc2ccccc21 |
| InChI | InChI=1S/C26H34N8O3/c1-6-34-21-10-8-7-9-20(21)29-23(34)19(13-27)22-17(2)14-28-25(30-22)31-24(35)18-11-12-33(15-18)16-36-32-37-26(3,4)5/h7-10,14,18,29,32H,6,11-12,15-16H2,1-5H3,(H,28,30,31,35)/b23-19+ |
| InChIKey | PIQNXJZXFKFOHD-FCDQGJHFSA-N |
| XLogP | 3.40 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|