C13H19NO — CID 143016459
1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-3-carbaldehyde (PubChem CID 143016459) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-3-carbaldehyde.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 143016459 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(CC2=CCCC=C2)C1 |
| InChI | InChI=1S/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h2,5-6,11,13H,1,3-4,7-10H2 |
| InChIKey | LWJMLEOCGXNMBZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|