C10H21N3O2 — CID 143018071
(Z)-2-amino-7-(1-aminoethylamino)-2-methylhept-4-enoic acid (PubChem CID 143018071) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (Z)-2-amino-7-(1-aminoethylamino)-2-methylhept-4-enoic acid.
| Compound Name | (Z)-2-amino-7-(1-aminoethylamino)-2-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 143018071 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (Z)-2-amino-7-(1-aminoethylamino)-2-methylhept-4-enoic acid |
| SMILES | CC(N)NCC/C=C\CC(C)(N)C(=O)O |
| InChI | InChI=1S/C10H21N3O2/c1-8(11)13-7-5-3-4-6-10(2,12)9(14)15/h3-4,8,13H,5-7,11-12H2,1-2H3,(H,14,15)/b4-3- |
| InChIKey | NSSFYHXZQIJZHP-ARJAWSKDSA-N |
| XLogP | 0.02 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|