C16H29NO6 — CID 143018575
3-[2-(1-propanoyloxybutoxycarbonylamino)ethyl]hexanoic acid (PubChem CID 143018575) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[2-(1-propanoyloxybutoxycarbonylamino)ethyl]hexanoic acid.
| Compound Name | 3-[2-(1-propanoyloxybutoxycarbonylamino)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 143018575 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 3-[2-(1-propanoyloxybutoxycarbonylamino)ethyl]hexanoic acid |
| SMILES | CCCC(CCNC(=O)OC(CCC)OC(=O)CC)CC(=O)O |
| InChI | InChI=1S/C16H29NO6/c1-4-7-12(11-13(18)19)9-10-17-16(21)23-15(8-5-2)22-14(20)6-3/h12,15H,4-11H2,1-3H3,(H,17,21)(H,18,19) |
| InChIKey | BUYRNNJUACDFEO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|